C22H21NO3 — CID 19113827
2-pentyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19113827) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-pentyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-pentyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19113827 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-pentyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCN1C(=O)c2oc3ccccc3c(=O)c2C1c1ccccc1 |
| InChI | InChI=1S/C22H21NO3/c1-2-3-9-14-23-19(15-10-5-4-6-11-15)18-20(24)16-12-7-8-13-17(16)26-21(18)22(23)25/h4-8,10-13,19H,2-3,9,14H2,1H3 |
| InChIKey | GZEHXYVWYBWWIV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|