C24H25NO5 — CID 27350267
(1R)-1-(3-butoxyphenyl)-2-(3-hydroxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 27350267) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (1R)-1-(3-butoxyphenyl)-2-(3-hydroxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-1-(3-butoxyphenyl)-2-(3-hydroxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 27350267 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (1R)-1-(3-butoxyphenyl)-2-(3-hydroxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc([C@@H]2c3c(oc4ccccc4c3=O)C(=O)N2CCCO)c1 |
| InChI | InChI=1S/C24H25NO5/c1-2-3-14-29-17-9-6-8-16(15-17)21-20-22(27)18-10-4-5-11-19(18)30-23(20)24(28)25(21)12-7-13-26/h4-6,8-11,15,21,26H,2-3,7,12-14H2,1H3/t21-/m1/s1 |
| InChIKey | WPVPRMUXWRYUQM-OAQYLSRUSA-N |
| XLogP | 3.90 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|