C22H21NO4 — CID 18879631
1-(3-butoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18879631) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18879631 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-(3-butoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4ccccc4c3=O)C(=O)N2C)c1 |
| InChI | InChI=1S/C22H21NO4/c1-3-4-12-26-15-9-7-8-14(13-15)19-18-20(24)16-10-5-6-11-17(16)27-21(18)22(25)23(19)2/h5-11,13,19H,3-4,12H2,1-2H3 |
| InChIKey | XGVOSFMVZQMVML-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|