C25H25NO6S — CID 40872165
(1R)-1-(3-butoxyphenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 40872165) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is (1R)-1-(3-butoxyphenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-1-(3-butoxyphenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 40872165 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (1R)-1-(3-butoxyphenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc([C@@H]2c3c(oc4ccccc4c3=O)C(=O)N2[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C25H25NO6S/c1-2-3-12-31-18-8-6-7-16(14-18)22-21-23(27)19-9-4-5-10-20(19)32-24(21)25(28)26(22)17-11-13-33(29,30)15-17/h4-10,14,17,22H,2-3,11-13,15H2,1H3/t17-,22+/m0/s1 |
| InChIKey | VNGBUQODYCGOOC-HTAPYJJXSA-N |
| XLogP | 3.70 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|