C29H33NO6S — CID 19120618
2-(1,1-dioxothiolan-3-yl)-1-(4-hexoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19120618) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(4-hexoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(4-hexoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19120618 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(4-hexoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C29H33NO6S/c1-4-5-6-7-13-35-22-10-8-20(9-11-22)26-25-27(31)23-15-18(2)19(3)16-24(23)36-28(25)29(32)30(26)21-12-14-37(33,34)17-21/h8-11,15-16,21,26H,4-7,12-14,17H2,1-3H3 |
| InChIKey | CGGHCZAEANUKCO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|