C24H20ClNO6S — CID 19120482
7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19120482) has the molecular formula C24H20ClNO6S and a molecular weight of 485.95 g/mol. Its IUPAC name is 7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19120482 |
| Molecular Formula | C24H20ClNO6S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H20ClNO6S/c1-2-10-31-17-6-3-14(4-7-17)21-20-22(27)18-12-15(25)5-8-19(18)32-23(20)24(28)26(21)16-9-11-33(29,30)13-16/h2-8,12,16,21H,1,9-11,13H2 |
| InChIKey | CXWDNUNDULCCLI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|