C22H18ClNO5 — CID 3497869
7-chloro-2-(2-hydroxyethyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 3497869) has the molecular formula C22H18ClNO5 and a molecular weight of 411.84 g/mol. Its IUPAC name is 7-chloro-2-(2-hydroxyethyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(2-hydroxyethyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 3497869 |
| Molecular Formula | C22H18ClNO5 |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 7-chloro-2-(2-hydroxyethyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2CCO)cc1 |
| InChI | InChI=1S/C22H18ClNO5/c1-2-11-28-15-6-3-13(4-7-15)19-18-20(26)16-12-14(23)5-8-17(16)29-21(18)22(27)24(19)9-10-25/h2-8,12,19,25H,1,9-11H2 |
| InChIKey | DGXJPXIJXMUAGK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|