C26H19ClN2O4 — CID 18819526
7-chloro-2-(4-methyl-2-pyridinyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18819526) has the molecular formula C26H19ClN2O4 and a molecular weight of 458.90 g/mol. Its IUPAC name is 7-chloro-2-(4-methyl-2-pyridinyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(4-methyl-2-pyridinyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18819526 |
| Molecular Formula | C26H19ClN2O4 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 7-chloro-2-(4-methyl-2-pyridinyl)-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2cc(C)ccn2)cc1 |
| InChI | InChI=1S/C26H19ClN2O4/c1-3-12-32-18-7-4-16(5-8-18)23-22-24(30)19-14-17(27)6-9-20(19)33-25(22)26(31)29(23)21-13-15(2)10-11-28-21/h3-11,13-14,23H,1,12H2,2H3 |
| InChIKey | GBRVSPVIJDTLQM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|