C26H25NO7S — CID 40872167
(1R)-2-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 40872167) has the molecular formula C26H25NO7S and a molecular weight of 495.55 g/mol. Its IUPAC name is (1R)-2-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-2-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 40872167 |
| Molecular Formula | C26H25NO7S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (1R)-2-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc([C@@H]2c3c(oc4ccccc4c3=O)C(=O)N2[C@@H]2CCS(=O)(=O)C2)cc1OCC |
| InChI | InChI=1S/C26H25NO7S/c1-3-12-33-20-10-9-16(14-21(20)32-4-2)23-22-24(28)18-7-5-6-8-19(18)34-25(22)26(29)27(23)17-11-13-35(30,31)15-17/h3,5-10,14,17,23H,1,4,11-13,15H2,2H3/t17-,23-/m1/s1 |
| InChIKey | XONXSJFGDHSNEK-UZUQRXQVSA-N |
| XLogP | 3.49 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|