C26H24ClNO7S — CID 19120503
7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19120503) has the molecular formula C26H24ClNO7S and a molecular weight of 530.00 g/mol. Its IUPAC name is 7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19120503 |
| Molecular Formula | C26H24ClNO7S |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 7-chloro-2-(1,1-dioxothiolan-3-yl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2C2CCS(=O)(=O)C2)cc1OCC |
| InChI | InChI=1S/C26H24ClNO7S/c1-3-10-34-20-7-5-15(12-21(20)33-4-2)23-22-24(29)18-13-16(27)6-8-19(18)35-25(22)26(30)28(23)17-9-11-36(31,32)14-17/h3,5-8,12-13,17,23H,1,4,9-11,14H2,2H3 |
| InChIKey | LNMYZFRARUWPHA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|