C31H26ClNO7 — CID 18853750
ethyl 4-[7-chloro-1-(3-ethoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18853750) has the molecular formula C31H26ClNO7 and a molecular weight of 560.00 g/mol. Its IUPAC name is ethyl 4-[7-chloro-1-(3-ethoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[7-chloro-1-(3-ethoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18853750 |
| Molecular Formula | C31H26ClNO7 |
| Molecular Weight | 560.00 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | ethyl 4-[7-chloro-1-(3-ethoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)cc1OCC |
| InChI | InChI=1S/C31H26ClNO7/c1-4-15-39-24-13-9-19(16-25(24)37-5-2)27-26-28(34)22-17-20(32)10-14-23(22)40-29(26)30(35)33(27)21-11-7-18(8-12-21)31(36)38-6-3/h4,7-14,16-17,27H,1,5-6,15H2,2-3H3 |
| InChIKey | UIARJQHNJFDRSN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.00 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|