C32H29NO6 — CID 18857108
2-(4-acetylphenyl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18857108) has the molecular formula C32H29NO6 and a molecular weight of 523.59 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(4-acetylphenyl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18857108 |
| Molecular Formula | C32H29NO6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-(4-acetylphenyl)-1-(3-ethoxy-4-prop-2-enoxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2ccc(C(C)=O)cc2)cc1OCC |
| InChI | InChI=1S/C32H29NO6/c1-6-14-38-25-13-10-22(17-27(25)37-7-2)29-28-30(35)24-15-18(3)19(4)16-26(24)39-31(28)32(36)33(29)23-11-8-21(9-12-23)20(5)34/h6,8-13,15-17,29H,1,7,14H2,2-5H3 |
| InChIKey | KAGCBUWBYIUTSZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|