C30H24ClNO7 — CID 18853894
ethyl 4-[7-chloro-1-(3-methoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18853894) has the molecular formula C30H24ClNO7 and a molecular weight of 545.98 g/mol. Its IUPAC name is ethyl 4-[7-chloro-1-(3-methoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[7-chloro-1-(3-methoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18853894 |
| Molecular Formula | C30H24ClNO7 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | ethyl 4-[7-chloro-1-(3-methoxy-4-prop-2-enoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)cc1OC |
| InChI | InChI=1S/C30H24ClNO7/c1-4-14-38-23-12-8-18(15-24(23)36-3)26-25-27(33)21-16-19(31)9-13-22(21)39-28(25)29(34)32(26)20-10-6-17(7-11-20)30(35)37-5-2/h4,6-13,15-16,26H,1,5,14H2,2-3H3 |
| InChIKey | ASAWCOLZYYVQGP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|