C35H37NO7 — CID 18857272
ethyl 4-[1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18857272) has the molecular formula C35H37NO7 and a molecular weight of 583.68 g/mol. Its IUPAC name is ethyl 4-[1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18857272 |
| Molecular Formula | C35H37NO7 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | ethyl 4-[1-(4-hexoxy-3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)cc1OC |
| InChI | InChI=1S/C35H37NO7/c1-6-8-9-10-17-42-27-16-13-24(20-29(27)40-5)31-30-32(37)26-18-21(3)22(4)19-28(26)43-33(30)34(38)36(31)25-14-11-23(12-15-25)35(39)41-7-2/h11-16,18-20,31H,6-10,17H2,1-5H3 |
| InChIKey | UBBIKFDDCYZZMK-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|