C32H32FNO5 — CID 18857157
1-(3-ethoxy-4-pentoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18857157) has the molecular formula C32H32FNO5 and a molecular weight of 529.61 g/mol. Its IUPAC name is 1-(3-ethoxy-4-pentoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-ethoxy-4-pentoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18857157 |
| Molecular Formula | C32H32FNO5 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 1-(3-ethoxy-4-pentoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C32H32FNO5/c1-5-7-8-15-38-25-14-9-21(18-27(25)37-6-2)29-28-30(35)24-16-19(3)20(4)17-26(24)39-31(28)32(36)34(29)23-12-10-22(33)11-13-23/h9-14,16-18,29H,5-8,15H2,1-4H3 |
| InChIKey | LFMVBGDGGRBIOV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|