C29H26FNO4 — CID 18856977
1-(3-butoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18856977) has the molecular formula C29H26FNO4 and a molecular weight of 471.53 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18856977 |
| Molecular Formula | C29H26FNO4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-(3-butoxyphenyl)-2-(4-fluorophenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C29H26FNO4/c1-4-5-13-34-22-8-6-7-19(16-22)26-25-27(32)23-14-17(2)18(3)15-24(23)35-28(25)29(33)31(26)21-11-9-20(30)10-12-21/h6-12,14-16,26H,4-5,13H2,1-3H3 |
| InChIKey | BNUWAVHMBSVBLW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|