C28H25NO4 — CID 18857968
1-(3-butoxyphenyl)-7-methyl-2-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18857968) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-7-methyl-2-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-7-methyl-2-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18857968 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-(3-butoxyphenyl)-7-methyl-2-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4ccc(C)cc4c3=O)C(=O)N2c2ccccc2)c1 |
| InChI | InChI=1S/C28H25NO4/c1-3-4-15-32-21-12-8-9-19(17-21)25-24-26(30)22-16-18(2)13-14-23(22)33-27(24)28(31)29(25)20-10-6-5-7-11-20/h5-14,16-17,25H,3-4,15H2,1-2H3 |
| InChIKey | WZWRVJMKBSDLMY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|