C30H29NO4 — CID 18856983
1-(3-butoxyphenyl)-6,7-dimethyl-2-(3-methylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18856983) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-6,7-dimethyl-2-(3-methylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-6,7-dimethyl-2-(3-methylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18856983 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-(3-butoxyphenyl)-6,7-dimethyl-2-(3-methylphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C30H29NO4/c1-5-6-13-34-23-12-8-10-21(17-23)27-26-28(32)24-15-19(3)20(4)16-25(24)35-29(26)30(33)31(27)22-11-7-9-18(2)14-22/h7-12,14-17,27H,5-6,13H2,1-4H3 |
| InChIKey | CKRCQWKDQRGDSC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|