C30H26F3NO4 — CID 18856975
1-(3-butoxyphenyl)-6,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18856975) has the molecular formula C30H26F3NO4 and a molecular weight of 521.54 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-6,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-butoxyphenyl)-6,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18856975 |
| Molecular Formula | C30H26F3NO4 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 1-(3-butoxyphenyl)-6,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1cccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H26F3NO4/c1-4-5-12-37-22-11-6-8-19(15-22)26-25-27(35)23-13-17(2)18(3)14-24(23)38-28(25)29(36)34(26)21-10-7-9-20(16-21)30(31,32)33/h6-11,13-16,26H,4-5,12H2,1-3H3 |
| InChIKey | AZQZVRHIZIAFQT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|