C33H32FNO7 — CID 18856168
ethyl 4-[1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18856168) has the molecular formula C33H32FNO7 and a molecular weight of 573.62 g/mol. Its IUPAC name is ethyl 4-[1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18856168 |
| Molecular Formula | C33H32FNO7 |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | ethyl 4-[1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)cc1OCC |
| InChI | InChI=1S/C33H32FNO7/c1-4-7-8-17-41-26-15-11-21(18-27(26)39-5-2)29-28-30(36)24-19-22(34)12-16-25(24)42-31(28)32(37)35(29)23-13-9-20(10-14-23)33(38)40-6-3/h9-16,18-19,29H,4-8,17H2,1-3H3 |
| InChIKey | FWWNICAMCFYBCI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|