C31H28FNO6 — CID 18855826
ethyl 4-[7-fluoro-3,9-dioxo-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18855826) has the molecular formula C31H28FNO6 and a molecular weight of 529.56 g/mol. Its IUPAC name is ethyl 4-[7-fluoro-3,9-dioxo-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[7-fluoro-3,9-dioxo-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18855826 |
| Molecular Formula | C31H28FNO6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | ethyl 4-[7-fluoro-3,9-dioxo-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C31H28FNO6/c1-3-5-6-17-38-23-14-9-19(10-15-23)27-26-28(34)24-18-21(32)11-16-25(24)39-29(26)30(35)33(27)22-12-7-20(8-13-22)31(36)37-4-2/h7-16,18,27H,3-6,17H2,1-2H3 |
| InChIKey | MIWLYPWXGYEOJW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|