C30H26ClNO6 — CID 18853151
butyl 4-[7-chloro-1-(4-ethoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18853151) has the molecular formula C30H26ClNO6 and a molecular weight of 531.99 g/mol. Its IUPAC name is butyl 4-[7-chloro-1-(4-ethoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[7-chloro-1-(4-ethoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18853151 |
| Molecular Formula | C30H26ClNO6 |
| Molecular Weight | 531.99 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | butyl 4-[7-chloro-1-(4-ethoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C2c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C30H26ClNO6/c1-3-5-16-37-30(35)19-6-11-21(12-7-19)32-26(18-8-13-22(14-9-18)36-4-2)25-27(33)23-17-20(31)10-15-24(23)38-28(25)29(32)34/h6-15,17,26H,3-5,16H2,1-2H3 |
| InChIKey | BSCKSTSHEAFXMX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.99 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|