C26H17ClN2O7 — CID 18853054
ethyl 4-[7-chloro-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18853054) has the molecular formula C26H17ClN2O7 and a molecular weight of 504.88 g/mol. Its IUPAC name is ethyl 4-[7-chloro-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[7-chloro-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18853054 |
| Molecular Formula | C26H17ClN2O7 |
| Molecular Weight | 504.88 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | ethyl 4-[7-chloro-1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H17ClN2O7/c1-2-35-26(32)15-5-8-17(9-6-15)28-22(14-3-10-18(11-4-14)29(33)34)21-23(30)19-13-16(27)7-12-20(19)36-24(21)25(28)31/h3-13,22H,2H2,1H3 |
| InChIKey | IEWQTCFYEPPHEG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|