C26H18N2O7 — CID 18852059
ethyl 4-[1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18852059) has the molecular formula C26H18N2O7 and a molecular weight of 470.44 g/mol. Its IUPAC name is ethyl 4-[1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18852059 |
| Molecular Formula | C26H18N2O7 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | ethyl 4-[1-(4-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)c3oc4ccccc4c(=O)c3C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H18N2O7/c1-2-34-26(31)16-9-11-17(12-10-16)27-22(15-7-13-18(14-8-15)28(32)33)21-23(29)19-5-3-4-6-20(19)35-24(21)25(27)30/h3-14,22H,2H2,1H3 |
| InChIKey | PXMZLLWXYSKEOM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|