C25H15ClN2O6 — CID 18853052
2-(4-acetylphenyl)-7-chloro-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18853052) has the molecular formula C25H15ClN2O6 and a molecular weight of 474.86 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-7-chloro-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(4-acetylphenyl)-7-chloro-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18853052 |
| Molecular Formula | C25H15ClN2O6 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-(4-acetylphenyl)-7-chloro-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H15ClN2O6/c1-13(29)14-2-7-17(8-3-14)27-22(15-4-9-18(10-5-15)28(32)33)21-23(30)19-12-16(26)6-11-20(19)34-24(21)25(27)31/h2-12,22H,1H3 |
| InChIKey | IJKCUXLMWROLJX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 110.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|