C24H15ClN2O5 — CID 18853018
7-chloro-2-(3-methylphenyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18853018) has the molecular formula C24H15ClN2O5 and a molecular weight of 446.85 g/mol. Its IUPAC name is 7-chloro-2-(3-methylphenyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(3-methylphenyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18853018 |
| Molecular Formula | C24H15ClN2O5 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 7-chloro-2-(3-methylphenyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1cccc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C2c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H15ClN2O5/c1-13-4-2-6-16(10-13)26-21(14-5-3-7-17(11-14)27(30)31)20-22(28)18-12-15(25)8-9-19(18)32-23(20)24(26)29/h2-12,21H,1H3 |
| InChIKey | YMIRVUXXYOBPOY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|