C29H25NO5 — CID 18851997
butyl 4-[1-(4-methylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18851997) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is butyl 4-[1-(4-methylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[1-(4-methylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18851997 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | butyl 4-[1-(4-methylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccccc4c(=O)c3C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H25NO5/c1-3-4-17-34-29(33)20-13-15-21(16-14-20)30-25(19-11-9-18(2)10-12-19)24-26(31)22-7-5-6-8-23(22)35-27(24)28(30)32/h5-16,25H,3-4,17H2,1-2H3 |
| InChIKey | UNHVUACXFVUALN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|