C30H27NO7 — CID 18857599
butyl 4-[1-(4-hydroxy-3-methoxyphenyl)-7-methyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18857599) has the molecular formula C30H27NO7 and a molecular weight of 513.55 g/mol. Its IUPAC name is butyl 4-[1-(4-hydroxy-3-methoxyphenyl)-7-methyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[1-(4-hydroxy-3-methoxyphenyl)-7-methyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18857599 |
| Molecular Formula | C30H27NO7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | butyl 4-[1-(4-hydroxy-3-methoxyphenyl)-7-methyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccc(C)cc4c(=O)c3C2c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H27NO7/c1-4-5-14-37-30(35)18-7-10-20(11-8-18)31-26(19-9-12-22(32)24(16-19)36-3)25-27(33)21-15-17(2)6-13-23(21)38-28(25)29(31)34/h6-13,15-16,26,32H,4-5,14H2,1-3H3 |
| InChIKey | BJQXYUYESMRBNG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|