C30H26BrNO7 — CID 18854610
butyl 4-[7-bromo-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18854610) has the molecular formula C30H26BrNO7 and a molecular weight of 592.44 g/mol. Its IUPAC name is butyl 4-[7-bromo-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[7-bromo-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18854610 |
| Molecular Formula | C30H26BrNO7 |
| Molecular Weight | 592.44 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | butyl 4-[7-bromo-1-(3-ethoxy-4-hydroxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccc(Br)cc4c(=O)c3C2c2ccc(O)c(OCC)c2)cc1 |
| InChI | InChI=1S/C30H26BrNO7/c1-3-5-14-38-30(36)17-6-10-20(11-7-17)32-26(18-8-12-22(33)24(15-18)37-4-2)25-27(34)21-16-19(31)9-13-23(21)39-28(25)29(32)35/h6-13,15-16,26,33H,3-5,14H2,1-2H3 |
| InChIKey | YQTLTTSYTVHBNZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|