C35H36ClNO7 — CID 18853811
butyl 4-[7-chloro-1-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18853811) has the molecular formula C35H36ClNO7 and a molecular weight of 618.13 g/mol. Its IUPAC name is butyl 4-[7-chloro-1-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[7-chloro-1-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18853811 |
| Molecular Formula | C35H36ClNO7 |
| Molecular Weight | 618.13 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | butyl 4-[7-chloro-1-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3C2c2ccc(OCCC(C)C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C35H36ClNO7/c1-5-7-17-43-35(40)22-8-12-25(13-9-22)37-31(23-10-14-28(29(19-23)41-6-2)42-18-16-21(3)4)30-32(38)26-20-24(36)11-15-27(26)44-33(30)34(37)39/h8-15,19-21,31H,5-7,16-18H2,1-4H3 |
| InChIKey | OKIWVGSUQNSHDH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.13 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|