C30H27BrClNO5 — CID 18853791
2-(4-bromophenyl)-7-chloro-1-(3-ethoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18853791) has the molecular formula C30H27BrClNO5 and a molecular weight of 596.91 g/mol. Its IUPAC name is 2-(4-bromophenyl)-7-chloro-1-(3-ethoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(4-bromophenyl)-7-chloro-1-(3-ethoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18853791 |
| Molecular Formula | C30H27BrClNO5 |
| Molecular Weight | 596.91 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | 2-(4-bromophenyl)-7-chloro-1-(3-ethoxy-4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2ccc(Br)cc2)cc1OCC |
| InChI | InChI=1S/C30H27BrClNO5/c1-3-5-6-15-37-24-13-7-18(16-25(24)36-4-2)27-26-28(34)22-17-20(32)10-14-23(22)38-29(26)30(35)33(27)21-11-8-19(31)9-12-21/h7-14,16-17,27H,3-6,15H2,1-2H3 |
| InChIKey | HSPSCSXCYRZZIJ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.91 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|