C28H24Cl2N2O5 — CID 18819515
1-(4-butoxy-3-ethoxyphenyl)-7-chloro-2-(5-chloro-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18819515) has the molecular formula C28H24Cl2N2O5 and a molecular weight of 539.42 g/mol. Its IUPAC name is 1-(4-butoxy-3-ethoxyphenyl)-7-chloro-2-(5-chloro-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-ethoxyphenyl)-7-chloro-2-(5-chloro-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18819515 |
| Molecular Formula | C28H24Cl2N2O5 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 1-(4-butoxy-3-ethoxyphenyl)-7-chloro-2-(5-chloro-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2ccc(Cl)cn2)cc1OCC |
| InChI | InChI=1S/C28H24Cl2N2O5/c1-3-5-12-36-21-9-6-16(13-22(21)35-4-2)25-24-26(33)19-14-17(29)7-10-20(19)37-27(24)28(34)32(25)23-11-8-18(30)15-31-23/h6-11,13-15,25H,3-5,12H2,1-2H3 |
| InChIKey | VLMFBVILMHRZPI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|