C32H30ClNO6 — CID 18853840
ethyl 4-[7-chloro-1-(4-hexoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18853840) has the molecular formula C32H30ClNO6 and a molecular weight of 560.05 g/mol. Its IUPAC name is ethyl 4-[7-chloro-1-(4-hexoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | ethyl 4-[7-chloro-1-(4-hexoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18853840 |
| Molecular Formula | C32H30ClNO6 |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | ethyl 4-[7-chloro-1-(4-hexoxyphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C32H30ClNO6/c1-3-5-6-7-18-39-24-15-10-20(11-16-24)28-27-29(35)25-19-22(33)12-17-26(25)40-30(27)31(36)34(28)23-13-8-21(9-14-23)32(37)38-4-2/h8-17,19,28H,3-7,18H2,1-2H3 |
| InChIKey | MPUDDIOHACJNKC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|