C28H21BrN2O7 — CID 18854358
butyl 4-[7-bromo-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18854358) has the molecular formula C28H21BrN2O7 and a molecular weight of 577.39 g/mol. Its IUPAC name is butyl 4-[7-bromo-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[7-bromo-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18854358 |
| Molecular Formula | C28H21BrN2O7 |
| Molecular Weight | 577.39 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | butyl 4-[7-bromo-1-(3-nitrophenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccc(Br)cc4c(=O)c3C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H21BrN2O7/c1-2-3-13-37-28(34)16-7-10-19(11-8-16)30-24(17-5-4-6-20(14-17)31(35)36)23-25(32)21-15-18(29)9-12-22(21)38-26(23)27(30)33/h4-12,14-15,24H,2-3,13H2,1H3 |
| InChIKey | KPMCQNYQNDGYHA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.39 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|