C30H26BrNO5 — CID 18856386
butyl 4-[1-(3-bromophenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18856386) has the molecular formula C30H26BrNO5 and a molecular weight of 560.44 g/mol. Its IUPAC name is butyl 4-[1-(3-bromophenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[1-(3-bromophenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18856386 |
| Molecular Formula | C30H26BrNO5 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | butyl 4-[1-(3-bromophenyl)-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4cc(C)c(C)cc4c(=O)c3C2c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C30H26BrNO5/c1-4-5-13-36-30(35)19-9-11-22(12-10-19)32-26(20-7-6-8-21(31)16-20)25-27(33)23-14-17(2)18(3)15-24(23)37-28(25)29(32)34/h6-12,14-16,26H,4-5,13H2,1-3H3 |
| InChIKey | YVBDJTKKUCWSMQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|