C32H30N2O7 — CID 18857225
butyl 4-[1-[4-(2-amino-2-oxoethoxy)phenyl]-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18857225) has the molecular formula C32H30N2O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is butyl 4-[1-[4-(2-amino-2-oxoethoxy)phenyl]-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[1-[4-(2-amino-2-oxoethoxy)phenyl]-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18857225 |
| Molecular Formula | C32H30N2O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | butyl 4-[1-[4-(2-amino-2-oxoethoxy)phenyl]-6,7-dimethyl-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4cc(C)c(C)cc4c(=O)c3C2c2ccc(OCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C32H30N2O7/c1-4-5-14-39-32(38)21-6-10-22(11-7-21)34-28(20-8-12-23(13-9-20)40-17-26(33)35)27-29(36)24-15-18(2)19(3)16-25(24)41-30(27)31(34)37/h6-13,15-16,28H,4-5,14,17H2,1-3H3,(H2,33,35) |
| InChIKey | DMFOGGPCQXRUQN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|