C29H24BrNO5S — CID 18855275
butyl 4-[7-bromo-1-(4-methylsulfanylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate (PubChem CID 18855275) has the molecular formula C29H24BrNO5S and a molecular weight of 578.48 g/mol. Its IUPAC name is butyl 4-[7-bromo-1-(4-methylsulfanylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate.
| Compound Name | butyl 4-[7-bromo-1-(4-methylsulfanylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 18855275 |
| Molecular Formula | C29H24BrNO5S |
| Molecular Weight | 578.48 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | butyl 4-[7-bromo-1-(4-methylsulfanylphenyl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3oc4ccc(Br)cc4c(=O)c3C2c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C29H24BrNO5S/c1-3-4-15-35-29(34)18-5-10-20(11-6-18)31-25(17-7-12-21(37-2)13-8-17)24-26(32)22-16-19(30)9-14-23(22)36-27(24)28(31)33/h5-14,16,25H,3-4,15H2,1-2H3 |
| InChIKey | WQXMNVCWQNWTEJ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.48 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|