C31H39NO5 — CID 18820520
1-(4-hexoxyphenyl)-6,7-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820520) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is 1-(4-hexoxyphenyl)-6,7-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-hexoxyphenyl)-6,7-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820520 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 1-(4-hexoxyphenyl)-6,7-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4cc(C)c(C)cc4c3=O)C(=O)N2CCCOC(C)C)cc1 |
| InChI | InChI=1S/C31H39NO5/c1-6-7-8-9-16-36-24-13-11-23(12-14-24)28-27-29(33)25-18-21(4)22(5)19-26(25)37-30(27)31(34)32(28)15-10-17-35-20(2)3/h11-14,18-20,28H,6-10,15-17H2,1-5H3 |
| InChIKey | DUQFJCVGAHAHBJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|