C28H33NO5 — CID 18820090
1-(4-butoxyphenyl)-7-methyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820090) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-7-methyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxyphenyl)-7-methyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820090 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 1-(4-butoxyphenyl)-7-methyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(C)cc4c3=O)C(=O)N2CCCOC(C)C)cc1 |
| InChI | InChI=1S/C28H33NO5/c1-5-6-15-33-21-11-9-20(10-12-21)25-24-26(30)22-17-19(4)8-13-23(22)34-27(24)28(31)29(25)14-7-16-32-18(2)3/h8-13,17-18,25H,5-7,14-16H2,1-4H3 |
| InChIKey | BBVZMSZQQCTDEL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|