C24H24ClNO4 — CID 18820222
7-chloro-1-(4-methylphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820222) has the molecular formula C24H24ClNO4 and a molecular weight of 425.91 g/mol. Its IUPAC name is 7-chloro-1-(4-methylphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(4-methylphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820222 |
| Molecular Formula | C24H24ClNO4 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 7-chloro-1-(4-methylphenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2CCCOC(C)C)cc1 |
| InChI | InChI=1S/C24H24ClNO4/c1-14(2)29-12-4-11-26-21(16-7-5-15(3)6-8-16)20-22(27)18-13-17(25)9-10-19(18)30-23(20)24(26)28/h5-10,13-14,21H,4,11-12H2,1-3H3 |
| InChIKey | FYKYGPGLHJROLI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|