C21H17BrClNO4 — CID 4706410
1-(4-bromophenyl)-7-chloro-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706410) has the molecular formula C21H17BrClNO4 and a molecular weight of 462.73 g/mol. Its IUPAC name is 1-(4-bromophenyl)-7-chloro-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-bromophenyl)-7-chloro-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706410 |
| Molecular Formula | C21H17BrClNO4 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | 1-(4-bromophenyl)-7-chloro-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COCCCN1C(=O)c2oc3ccc(Cl)cc3c(=O)c2C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H17BrClNO4/c1-27-10-2-9-24-18(12-3-5-13(22)6-4-12)17-19(25)15-11-14(23)7-8-16(15)28-20(17)21(24)26/h3-8,11,18H,2,9-10H2,1H3 |
| InChIKey | JLLYWKQUHDONCW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|