C21H18FNO5 — CID 4706574
7-fluoro-1-(4-hydroxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706574) has the molecular formula C21H18FNO5 and a molecular weight of 383.38 g/mol. Its IUPAC name is 7-fluoro-1-(4-hydroxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-1-(4-hydroxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706574 |
| Molecular Formula | C21H18FNO5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 7-fluoro-1-(4-hydroxyphenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COCCCN1C(=O)c2oc3ccc(F)cc3c(=O)c2C1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H18FNO5/c1-27-10-2-9-23-18(12-3-6-14(24)7-4-12)17-19(25)15-11-13(22)5-8-16(15)28-20(17)21(23)26/h3-8,11,18,24H,2,9-10H2,1H3 |
| InChIKey | OBTIGMBBQHZZAW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|