C21H16Cl3NO4 — CID 4706409
7-chloro-1-(3,4-dichlorophenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706409) has the molecular formula C21H16Cl3NO4 and a molecular weight of 452.72 g/mol. Its IUPAC name is 7-chloro-1-(3,4-dichlorophenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(3,4-dichlorophenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706409 |
| Molecular Formula | C21H16Cl3NO4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 7-chloro-1-(3,4-dichlorophenyl)-2-(3-methoxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COCCCN1C(=O)c2oc3ccc(Cl)cc3c(=O)c2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl3NO4/c1-28-8-2-7-25-18(11-3-5-14(23)15(24)9-11)17-19(26)13-10-12(22)4-6-16(13)29-20(17)21(25)27/h3-6,9-10,18H,2,7-8H2,1H3 |
| InChIKey | LXTMQRQNVARZME-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|