C20H15FN2O6 — CID 3776570
7-fluoro-2-(3-hydroxypropyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 3776570) has the molecular formula C20H15FN2O6 and a molecular weight of 398.35 g/mol. Its IUPAC name is 7-fluoro-2-(3-hydroxypropyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-2-(3-hydroxypropyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 3776570 |
| Molecular Formula | C20H15FN2O6 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 7-fluoro-2-(3-hydroxypropyl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(F)cc3c(=O)c2C(c2cccc([N+](=O)[O-])c2)N1CCCO |
| InChI | InChI=1S/C20H15FN2O6/c21-12-5-6-15-14(10-12)18(25)16-17(11-3-1-4-13(9-11)23(27)28)22(7-2-8-24)20(26)19(16)29-15/h1,3-6,9-10,17,24H,2,7-8H2 |
| InChIKey | CTKQQNYIUIXHKD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|