C25H15FN2O7 — CID 2213994
(1R)-2-(1,3-benzodioxol-5-ylmethyl)-7-fluoro-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 2213994) has the molecular formula C25H15FN2O7 and a molecular weight of 474.40 g/mol. Its IUPAC name is (1R)-2-(1,3-benzodioxol-5-ylmethyl)-7-fluoro-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-2-(1,3-benzodioxol-5-ylmethyl)-7-fluoro-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 2213994 |
| Molecular Formula | C25H15FN2O7 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | (1R)-2-(1,3-benzodioxol-5-ylmethyl)-7-fluoro-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(F)cc3c(=O)c2[C@@H](c2cccc([N+](=O)[O-])c2)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H15FN2O7/c26-15-5-7-18-17(10-15)23(29)21-22(14-2-1-3-16(9-14)28(31)32)27(25(30)24(21)35-18)11-13-4-6-19-20(8-13)34-12-33-19/h1-10,22H,11-12H2/t22-/m1/s1 |
| InChIKey | QIFQCTHIABMWIH-JOCHJYFZSA-N |
| XLogP | 4.31 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|