C24H14F2N2O5 — CID 18810250
7-fluoro-2-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18810250) has the molecular formula C24H14F2N2O5 and a molecular weight of 448.38 g/mol. Its IUPAC name is 7-fluoro-2-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-2-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18810250 |
| Molecular Formula | C24H14F2N2O5 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 7-fluoro-2-[(4-fluorophenyl)methyl]-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(F)cc3c(=O)c2C(c2ccc([N+](=O)[O-])cc2)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H14F2N2O5/c25-15-5-1-13(2-6-15)12-27-21(14-3-8-17(9-4-14)28(31)32)20-22(29)18-11-16(26)7-10-19(18)33-23(20)24(27)30/h1-11,21H,12H2 |
| InChIKey | FRWLAVANAYSQRA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|