C18H11FN2O5 — CID 92951290
(1S)-7-fluoro-2-methyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 92951290) has the molecular formula C18H11FN2O5 and a molecular weight of 354.29 g/mol. Its IUPAC name is (1S)-7-fluoro-2-methyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1S)-7-fluoro-2-methyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 92951290 |
| Molecular Formula | C18H11FN2O5 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (1S)-7-fluoro-2-methyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CN1C(=O)c2oc3ccc(F)cc3c(=O)c2[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H11FN2O5/c1-20-15(9-2-5-11(6-3-9)21(24)25)14-16(22)12-8-10(19)4-7-13(12)26-17(14)18(20)23/h2-8,15H,1H3/t15-/m0/s1 |
| InChIKey | QPDMCDFTWGZOBE-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|