C22H15FN4O5S — CID 18820720
7-fluoro-1-(4-nitrophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820720) has the molecular formula C22H15FN4O5S and a molecular weight of 466.45 g/mol. Its IUPAC name is 7-fluoro-1-(4-nitrophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-1-(4-nitrophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820720 |
| Molecular Formula | C22H15FN4O5S |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 7-fluoro-1-(4-nitrophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCc1nnc(N2C(=O)c3oc4ccc(F)cc4c(=O)c3C2c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C22H15FN4O5S/c1-2-3-16-24-25-22(33-16)26-18(11-4-7-13(8-5-11)27(30)31)17-19(28)14-10-12(23)6-9-15(14)32-20(17)21(26)29/h4-10,18H,2-3H2,1H3 |
| InChIKey | AYKVUTPFPIUMQS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|