C25H22FN3O4S — CID 4707345
1-(4-butoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4707345) has the molecular formula C25H22FN3O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4707345 |
| Molecular Formula | C25H22FN3O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 1-(4-butoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2c2nnc(CC)s2)cc1 |
| InChI | InChI=1S/C25H22FN3O4S/c1-3-5-12-32-16-9-6-14(7-10-16)21-20-22(30)17-13-15(26)8-11-18(17)33-23(20)24(31)29(21)25-28-27-19(4-2)34-25/h6-11,13,21H,3-5,12H2,1-2H3 |
| InChIKey | RSCARCBYEOBBKI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|