C24H18FN3O4S — CID 4707359
2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4707359) has the molecular formula C24H18FN3O4S and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4707359 |
| Molecular Formula | C24H18FN3O4S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-(5-ethyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1cccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2c2nnc(CC)s2)c1 |
| InChI | InChI=1S/C24H18FN3O4S/c1-3-10-31-15-7-5-6-13(11-15)20-19-21(29)16-12-14(25)8-9-17(16)32-22(19)23(30)28(20)24-27-26-18(4-2)33-24/h3,5-9,11-12,20H,1,4,10H2,2H3 |
| InChIKey | CPUILCPRKPVPEU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|